C16H22N2O6 — CID 101456273
(1R,2S,3R,4R,5S)-3-(4-methoxyphenyl)-2,4-dinitro-5-propan-2-ylcyclohexan-1-ol (PubChem CID 101456273) has the molecular formula C16H22N2O6 and a molecular weight of 338.36 g/mol. Its IUPAC name is (1R,2S,3R,4R,5S)-3-(4-methoxyphenyl)-2,4-dinitro-5-propan-2-ylcyclohexan-1-ol.
| Compound Name | (1R,2S,3R,4R,5S)-3-(4-methoxyphenyl)-2,4-dinitro-5-propan-2-ylcyclohexan-1-ol |
|---|---|
| PubChem CID | 101456273 |
| Molecular Formula | C16H22N2O6 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | (1R,2S,3R,4R,5S)-3-(4-methoxyphenyl)-2,4-dinitro-5-propan-2-ylcyclohexan-1-ol |
| SMILES | COc1ccc([C@H]2[C@H]([N+](=O)[O-])[C@H](O)C[C@@H](C(C)C)[C@H]2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H22N2O6/c1-9(2)12-8-13(19)16(18(22)23)14(15(12)17(20)21)10-4-6-11(24-3)7-5-10/h4-7,9,12-16,19H,8H2,1-3H3/t12-,13+,14+,15+,16+/m0/s1 |
| InChIKey | QVPCIADXOAKFFP-UYJHQMFVSA-N |
| XLogP | 2.11 |
| TPSA | 115.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|