C16H21NO5 — CID 101493454
(3S,4S,4aR,8aS)-4-(4-methoxyphenyl)-3-nitro-2,3,4,4a,5,6,7,8-octahydrochromen-8a-ol (PubChem CID 101493454) has the molecular formula C16H21NO5 and a molecular weight of 307.35 g/mol. Its IUPAC name is (3S,4S,4aR,8aS)-4-(4-methoxyphenyl)-3-nitro-2,3,4,4a,5,6,7,8-octahydrochromen-8a-ol.
| Compound Name | (3S,4S,4aR,8aS)-4-(4-methoxyphenyl)-3-nitro-2,3,4,4a,5,6,7,8-octahydrochromen-8a-ol |
|---|---|
| PubChem CID | 101493454 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | (3S,4S,4aR,8aS)-4-(4-methoxyphenyl)-3-nitro-2,3,4,4a,5,6,7,8-octahydrochromen-8a-ol |
| SMILES | COc1ccc([C@H]2[C@H]([N+](=O)[O-])CO[C@@]3(O)CCCC[C@H]23)cc1 |
| InChI | InChI=1S/C16H21NO5/c1-21-12-7-5-11(6-8-12)15-13-4-2-3-9-16(13,18)22-10-14(15)17(19)20/h5-8,13-15,18H,2-4,9-10H2,1H3/t13-,14-,15-,16+/m1/s1 |
| InChIKey | CSDHWBLKXOLGPP-FPCVCCKLSA-N |
| XLogP | 2.33 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|