C17H18O2S2 — CID 19989635
2-[4-[(3-methoxyphenyl)methoxy]phenyl]-1,3-dithiolane (PubChem CID 19989635) has the molecular formula C17H18O2S2 and a molecular weight of 318.46 g/mol. Its IUPAC name is 2-[4-[(3-methoxyphenyl)methoxy]phenyl]-1,3-dithiolane.
| Compound Name | 2-[4-[(3-methoxyphenyl)methoxy]phenyl]-1,3-dithiolane |
|---|---|
| PubChem CID | 19989635 |
| Molecular Formula | C17H18O2S2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 2-[4-[(3-methoxyphenyl)methoxy]phenyl]-1,3-dithiolane |
| SMILES | COc1cccc(COc2ccc(C3SCCS3)cc2)c1 |
| InChI | InChI=1S/C17H18O2S2/c1-18-16-4-2-3-13(11-16)12-19-15-7-5-14(6-8-15)17-20-9-10-21-17/h2-8,11,17H,9-10,12H2,1H3 |
| InChIKey | JBFZLEPBCUFHEU-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |