C11H11NS2 — CID 168796589
2-(4-isocyanophenyl)-1,3-dithiane (PubChem CID 168796589) has the molecular formula C11H11NS2 and a molecular weight of 221.35 g/mol. Its IUPAC name is 2-(4-isocyanophenyl)-1,3-dithiane.
| Compound Name | 2-(4-isocyanophenyl)-1,3-dithiane |
|---|---|
| PubChem CID | 168796589 |
| Molecular Formula | C11H11NS2 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | 2-(4-isocyanophenyl)-1,3-dithiane |
| SMILES | [C-]#[N+]c1ccc(C2SCCCS2)cc1 |
| InChI | InChI=1S/C11H11NS2/c1-12-10-5-3-9(4-6-10)11-13-7-2-8-14-11/h3-6,11H,2,7-8H2 |
| InChIKey | OCBTYIAHYNYSTB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|