C19H28S2 — CID 139613379
2-[4-(4-propylcyclohexyl)phenyl]-1,3-dithiane (PubChem CID 139613379) has the molecular formula C19H28S2 and a molecular weight of 320.57 g/mol. Its IUPAC name is 2-[4-(4-propylcyclohexyl)phenyl]-1,3-dithiane.
| Compound Name | 2-[4-(4-propylcyclohexyl)phenyl]-1,3-dithiane |
|---|---|
| PubChem CID | 139613379 |
| Molecular Formula | C19H28S2 |
| Molecular Weight | 320.57 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 2-[4-(4-propylcyclohexyl)phenyl]-1,3-dithiane |
| SMILES | CCCC1CCC(c2ccc(C3SCCCS3)cc2)CC1 |
| InChI | InChI=1S/C19H28S2/c1-2-4-15-5-7-16(8-6-15)17-9-11-18(12-10-17)19-20-13-3-14-21-19/h9-12,15-16,19H,2-8,13-14H2,1H3 |
| InChIKey | AIDJFMDEDUWGID-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.57 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |