C7H9NO4 — CID 126971567
methyl 5-methyl-2,4-dioxopyrrolidine-3-carboxylate (PubChem CID 126971567) has the molecular formula C7H9NO4 and a molecular weight of 171.15 g/mol. Its IUPAC name is methyl 5-methyl-2,4-dioxopyrrolidine-3-carboxylate.
| Compound Name | methyl 5-methyl-2,4-dioxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 126971567 |
| Molecular Formula | C7H9NO4 |
| Molecular Weight | 171.15 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | methyl 5-methyl-2,4-dioxopyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1C(=O)NC(C)C1=O |
| InChI | InChI=1S/C7H9NO4/c1-3-5(9)4(6(10)8-3)7(11)12-2/h3-4H,1-2H3,(H,8,10) |
| InChIKey | BPOTVBNBQZLAMM-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.15 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|