C7H11NO6 — CID 130020032
methyl 3,4,5-trihydroxy-6-oxopiperidine-2-carboxylate (PubChem CID 130020032) has the molecular formula C7H11NO6 and a molecular weight of 205.17 g/mol. Its IUPAC name is methyl 3,4,5-trihydroxy-6-oxopiperidine-2-carboxylate.
| Compound Name | methyl 3,4,5-trihydroxy-6-oxopiperidine-2-carboxylate |
|---|---|
| PubChem CID | 130020032 |
| Molecular Formula | C7H11NO6 |
| Molecular Weight | 205.17 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | methyl 3,4,5-trihydroxy-6-oxopiperidine-2-carboxylate |
| SMILES | COC(=O)C1NC(=O)C(O)C(O)C1O |
| InChI | InChI=1S/C7H11NO6/c1-14-7(13)2-3(9)4(10)5(11)6(12)8-2/h2-5,9-11H,1H3,(H,8,12) |
| InChIKey | VJBUYQRMKMBQPC-UHFFFAOYSA-N |
| XLogP | -3.26 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.17 |
| LogP ≤ 5 | -3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |