methyl (2S,3S,4R)-3,4-dihydroxypiperidine-2-carboxylate

C7H13NO4 — CID 178197389

IUPACmethyl (2S,3S,4R)-3,4-dihydroxypiperidine-2-carboxylate
SMILESCOC(=O)[C@H]1NCC[C@@H](O)[C@H]1O
InChIInChI=1S/C7H13NO4/c1-12-7(11)5-6(10)4(9)2-3-8-5/h4-6,8-10H,2-3H2,1H3/t4-,5+,6-/m1/s1
InChIKeyGPMSNDBYFDPQMP-NGJCXOISSA-N
MW175.18 g/mol
LogP-1.76
Rot. Bonds1

About methyl (2S,3S,4R)-3,4-dihydroxypiperidine-2-carboxylate

methyl (2S,3S,4R)-3,4-dihydroxypiperidine-2-carboxylate (PubChem CID 178197389) has the molecular formula C7H13NO4 and a molecular weight of 175.18 g/mol. Its IUPAC name is methyl (2S,3S,4R)-3,4-dihydroxypiperidine-2-carboxylate.

Molecular Properties

Compound Namemethyl (2S,3S,4R)-3,4-dihydroxypiperidine-2-carboxylate
PubChem CID178197389
Molecular FormulaC7H13NO4
Molecular Weight175.18 g/mol
Exact Mass175.08
IUPAC Namemethyl (2S,3S,4R)-3,4-dihydroxypiperidine-2-carboxylate
SMILESCOC(=O)[C@H]1NCC[C@@H](O)[C@H]1O
InChIInChI=1S/C7H13NO4/c1-12-7(11)5-6(10)4(9)2-3-8-5/h4-6,8-10H,2-3H2,1H3/t4-,5+,6-/m1/s1
InChIKeyGPMSNDBYFDPQMP-NGJCXOISSA-N
XLogP-1.76
TPSA78.79 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500175.18
LogP ≤ 5-1.76
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze methyl (2S,3S,4R)-3,4-dihydroxypiperidine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2S,3S,4R)-3,4-dihydroxypiperidine-2-carboxylate?
The IUPAC name of methyl (2S,3S,4R)-3,4-dihydroxypiperidine-2-carboxylate (CID 178197389) is methyl (2S,3S,4R)-3,4-dihydroxypiperidine-2-carboxylate.
What is the SMILES notation for methyl (2S,3S,4R)-3,4-dihydroxypiperidine-2-carboxylate?
The canonical SMILES for methyl (2S,3S,4R)-3,4-dihydroxypiperidine-2-carboxylate is COC(=O)[C@H]1NCC[C@@H](O)[C@H]1O.
What is the InChIKey of methyl (2S,3S,4R)-3,4-dihydroxypiperidine-2-carboxylate?
The InChIKey is GPMSNDBYFDPQMP-NGJCXOISSA-N. The full InChI is InChI=1S/C7H13NO4/c1-12-7(11)5-6(10)4(9)2-3-8-5/h4-6,8-10H,2-3H2,1H3/t4-,5+,6-/m1/s1.
What are the key properties of methyl (2S,3S,4R)-3,4-dihydroxypiperidine-2-carboxylate?
methyl (2S,3S,4R)-3,4-dihydroxypiperidine-2-carboxylate has a molecular weight of 175.18 g/mol, XLogP of -1.76, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S,3S,4R)-3,4-dihydroxypiperidine-2-carboxylate is sourced from PubChem (CID 178197389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).