C7H13NO4 — CID 178197389
methyl (2S,3S,4R)-3,4-dihydroxypiperidine-2-carboxylate (PubChem CID 178197389) has the molecular formula C7H13NO4 and a molecular weight of 175.18 g/mol. Its IUPAC name is methyl (2S,3S,4R)-3,4-dihydroxypiperidine-2-carboxylate.
| Compound Name | methyl (2S,3S,4R)-3,4-dihydroxypiperidine-2-carboxylate |
|---|---|
| PubChem CID | 178197389 |
| Molecular Formula | C7H13NO4 |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | methyl (2S,3S,4R)-3,4-dihydroxypiperidine-2-carboxylate |
| SMILES | COC(=O)[C@H]1NCC[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C7H13NO4/c1-12-7(11)5-6(10)4(9)2-3-8-5/h4-6,8-10H,2-3H2,1H3/t4-,5+,6-/m1/s1 |
| InChIKey | GPMSNDBYFDPQMP-NGJCXOISSA-N |
| XLogP | -1.76 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |