C6H12N2O2 — CID 45090024
methyl (2S,3R)-3-aminopyrrolidine-2-carboxylate (PubChem CID 45090024) has the molecular formula C6H12N2O2 and a molecular weight of 144.17 g/mol. Its IUPAC name is methyl (2S,3R)-3-aminopyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,3R)-3-aminopyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 45090024 |
| Molecular Formula | C6H12N2O2 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | methyl (2S,3R)-3-aminopyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@H]1NCC[C@H]1N |
| InChI | InChI=1S/C6H12N2O2/c1-10-6(9)5-4(7)2-3-8-5/h4-5,8H,2-3,7H2,1H3/t4-,5+/m1/s1 |
| InChIKey | MSLIIQYVCXQTQP-UHNVWZDZSA-N |
| XLogP | -1.15 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |