C8H8O4 — CID 124708334
methyl (1S)-3-methyl-2,5-dioxocyclopent-3-ene-1-carboxylate (PubChem CID 124708334) has the molecular formula C8H8O4 and a molecular weight of 168.15 g/mol. Its IUPAC name is methyl (1S)-3-methyl-2,5-dioxocyclopent-3-ene-1-carboxylate.
| Compound Name | methyl (1S)-3-methyl-2,5-dioxocyclopent-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 124708334 |
| Molecular Formula | C8H8O4 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | methyl (1S)-3-methyl-2,5-dioxocyclopent-3-ene-1-carboxylate |
| SMILES | COC(=O)[C@H]1C(=O)C=C(C)C1=O |
| InChI | InChI=1S/C8H8O4/c1-4-3-5(9)6(7(4)10)8(11)12-2/h3,6H,1-2H3/t6-/m0/s1 |
| InChIKey | QVVJGYWKTFUEBT-LURJTMIESA-N |
| XLogP | -0.13 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|