C12H11NO6 — CID 175879304
dimethyl (3S)-5,7-dioxo-3H-indolizine-3,6-dicarboxylate (PubChem CID 175879304) has the molecular formula C12H11NO6 and a molecular weight of 265.22 g/mol. Its IUPAC name is dimethyl (3S)-5,7-dioxo-3H-indolizine-3,6-dicarboxylate.
| Compound Name | dimethyl (3S)-5,7-dioxo-3H-indolizine-3,6-dicarboxylate |
|---|---|
| PubChem CID | 175879304 |
| Molecular Formula | C12H11NO6 |
| Molecular Weight | 265.22 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | dimethyl (3S)-5,7-dioxo-3H-indolizine-3,6-dicarboxylate |
| SMILES | COC(=O)C1C(=O)C=C2C=C[C@@H](C(=O)OC)N2C1=O |
| InChI | InChI=1S/C12H11NO6/c1-18-11(16)7-4-3-6-5-8(14)9(12(17)19-2)10(15)13(6)7/h3-5,7,9H,1-2H3/t7-,9?/m0/s1 |
| InChIKey | QPHLYWVMDSKXDU-JAVCKPHESA-N |
| XLogP | -0.82 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.22 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|