C14H15NO6 — CID 175429951
diethyl (3R)-5,7-dioxo-3H-indolizine-3,6-dicarboxylate (PubChem CID 175429951) has the molecular formula C14H15NO6 and a molecular weight of 293.28 g/mol. Its IUPAC name is diethyl (3R)-5,7-dioxo-3H-indolizine-3,6-dicarboxylate.
| Compound Name | diethyl (3R)-5,7-dioxo-3H-indolizine-3,6-dicarboxylate |
|---|---|
| PubChem CID | 175429951 |
| Molecular Formula | C14H15NO6 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | diethyl (3R)-5,7-dioxo-3H-indolizine-3,6-dicarboxylate |
| SMILES | CCOC(=O)C1C(=O)C=C2C=C[C@H](C(=O)OCC)N2C1=O |
| InChI | InChI=1S/C14H15NO6/c1-3-20-13(18)9-6-5-8-7-10(16)11(12(17)15(8)9)14(19)21-4-2/h5-7,9,11H,3-4H2,1-2H3/t9-,11?/m1/s1 |
| InChIKey | YSMKERKUHOTQHA-BFHBGLAWSA-N |
| XLogP | -0.04 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|