C10H12FNO4 — CID 91567875
ethyl 5-fluoro-1,6-dimethyl-2,4-dioxopyridine-3-carboxylate (PubChem CID 91567875) has the molecular formula C10H12FNO4 and a molecular weight of 229.21 g/mol. Its IUPAC name is ethyl 5-fluoro-1,6-dimethyl-2,4-dioxopyridine-3-carboxylate.
| Compound Name | ethyl 5-fluoro-1,6-dimethyl-2,4-dioxopyridine-3-carboxylate |
|---|---|
| PubChem CID | 91567875 |
| Molecular Formula | C10H12FNO4 |
| Molecular Weight | 229.21 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | ethyl 5-fluoro-1,6-dimethyl-2,4-dioxopyridine-3-carboxylate |
| SMILES | CCOC(=O)C1C(=O)C(F)=C(C)N(C)C1=O |
| InChI | InChI=1S/C10H12FNO4/c1-4-16-10(15)6-8(13)7(11)5(2)12(3)9(6)14/h6H,4H2,1-3H3 |
| InChIKey | FOJLMJLKDTYLAG-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.21 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|