C7H9NO5 — CID 118148165
ethyl 3-methyl-2,4-dioxo-1,3-oxazolidine-5-carboxylate (PubChem CID 118148165) has the molecular formula C7H9NO5 and a molecular weight of 187.15 g/mol. Its IUPAC name is ethyl 3-methyl-2,4-dioxo-1,3-oxazolidine-5-carboxylate.
| Compound Name | ethyl 3-methyl-2,4-dioxo-1,3-oxazolidine-5-carboxylate |
|---|---|
| PubChem CID | 118148165 |
| Molecular Formula | C7H9NO5 |
| Molecular Weight | 187.15 g/mol |
| Exact Mass | 187.05 |
| IUPAC Name | ethyl 3-methyl-2,4-dioxo-1,3-oxazolidine-5-carboxylate |
| SMILES | CCOC(=O)C1OC(=O)N(C)C1=O |
| InChI | InChI=1S/C7H9NO5/c1-3-12-6(10)4-5(9)8(2)7(11)13-4/h4H,3H2,1-2H3 |
| InChIKey | XCWQTGVFRLUMDL-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.15 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|