C13H12ClNO4 — CID 74222338
ethyl 5-chloro-1-methyl-2,4-dioxoquinoline-3-carboxylate (PubChem CID 74222338) has the molecular formula C13H12ClNO4 and a molecular weight of 281.70 g/mol. Its IUPAC name is ethyl 5-chloro-1-methyl-2,4-dioxoquinoline-3-carboxylate.
| Compound Name | ethyl 5-chloro-1-methyl-2,4-dioxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 74222338 |
| Molecular Formula | C13H12ClNO4 |
| Molecular Weight | 281.70 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | ethyl 5-chloro-1-methyl-2,4-dioxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)C1C(=O)c2c(Cl)cccc2N(C)C1=O |
| InChI | InChI=1S/C13H12ClNO4/c1-3-19-13(18)10-11(16)9-7(14)5-4-6-8(9)15(2)12(10)17/h4-6,10H,3H2,1-2H3 |
| InChIKey | UQOLKMFKXUNYIV-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.70 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|