C13H13ClN2O4 — CID 124676693
ethyl (2S)-4-(2-chlorophenyl)-5,6-dioxopiperazine-2-carboxylate (PubChem CID 124676693) has the molecular formula C13H13ClN2O4 and a molecular weight of 296.71 g/mol. Its IUPAC name is ethyl (2S)-4-(2-chlorophenyl)-5,6-dioxopiperazine-2-carboxylate.
| Compound Name | ethyl (2S)-4-(2-chlorophenyl)-5,6-dioxopiperazine-2-carboxylate |
|---|---|
| PubChem CID | 124676693 |
| Molecular Formula | C13H13ClN2O4 |
| Molecular Weight | 296.71 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | ethyl (2S)-4-(2-chlorophenyl)-5,6-dioxopiperazine-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CN(c2ccccc2Cl)C(=O)C(=O)N1 |
| InChI | InChI=1S/C13H13ClN2O4/c1-2-20-13(19)9-7-16(12(18)11(17)15-9)10-6-4-3-5-8(10)14/h3-6,9H,2,7H2,1H3,(H,15,17)/t9-/m0/s1 |
| InChIKey | VKDPPAHJYFBNLO-VIFPVBQESA-N |
| XLogP | 0.73 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.71 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|