C10H16N2O5 — CID 119053586
ethyl 4-(2-methoxyethyl)-5,6-dioxopiperazine-2-carboxylate (PubChem CID 119053586) has the molecular formula C10H16N2O5 and a molecular weight of 244.25 g/mol. Its IUPAC name is ethyl 4-(2-methoxyethyl)-5,6-dioxopiperazine-2-carboxylate.
| Compound Name | ethyl 4-(2-methoxyethyl)-5,6-dioxopiperazine-2-carboxylate |
|---|---|
| PubChem CID | 119053586 |
| Molecular Formula | C10H16N2O5 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | ethyl 4-(2-methoxyethyl)-5,6-dioxopiperazine-2-carboxylate |
| SMILES | CCOC(=O)C1CN(CCOC)C(=O)C(=O)N1 |
| InChI | InChI=1S/C10H16N2O5/c1-3-17-10(15)7-6-12(4-5-16-2)9(14)8(13)11-7/h7H,3-6H2,1-2H3,(H,11,13) |
| InChIKey | MOMFCANZTRMJOV-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|