C10H17NO4 — CID 102569899
methyl 1-(2-methoxyethyl)-6-oxopiperidine-3-carboxylate (PubChem CID 102569899) has the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. Its IUPAC name is methyl 1-(2-methoxyethyl)-6-oxopiperidine-3-carboxylate.
| Compound Name | methyl 1-(2-methoxyethyl)-6-oxopiperidine-3-carboxylate |
|---|---|
| PubChem CID | 102569899 |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | methyl 1-(2-methoxyethyl)-6-oxopiperidine-3-carboxylate |
| SMILES | COCCN1CC(C(=O)OC)CCC1=O |
| InChI | InChI=1S/C10H17NO4/c1-14-6-5-11-7-8(10(13)15-2)3-4-9(11)12/h8H,3-7H2,1-2H3 |
| InChIKey | CRZPWWKCBPBODC-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |