C16H27N3O4 — CID 131918848
4-[1-(2-methoxyethyl)-6-oxopiperidine-3-carbonyl]-1-propylpiperazin-2-one (PubChem CID 131918848) has the molecular formula C16H27N3O4 and a molecular weight of 325.41 g/mol. Its IUPAC name is 4-[1-(2-methoxyethyl)-6-oxopiperidine-3-carbonyl]-1-propylpiperazin-2-one.
| Compound Name | 4-[1-(2-methoxyethyl)-6-oxopiperidine-3-carbonyl]-1-propylpiperazin-2-one |
|---|---|
| PubChem CID | 131918848 |
| Molecular Formula | C16H27N3O4 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 4-[1-(2-methoxyethyl)-6-oxopiperidine-3-carbonyl]-1-propylpiperazin-2-one |
| SMILES | CCCN1CCN(C(=O)C2CCC(=O)N(CCOC)C2)CC1=O |
| InChI | InChI=1S/C16H27N3O4/c1-3-6-17-7-8-19(12-15(17)21)16(22)13-4-5-14(20)18(11-13)9-10-23-2/h13H,3-12H2,1-2H3 |
| InChIKey | VYAHZZNKVJIKSM-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |