About 5-[4-(2,6-dimethyl-4-pyridinyl)piperazine-1-carbonyl]-1-(2-methoxyethyl)piperidin-2-one
5-[4-(2,6-dimethyl-4-pyridinyl)piperazine-1-carbonyl]-1-(2-methoxyethyl)piperidin-2-one (PubChem CID 45192162) has the molecular formula C20H30N4O3
and a molecular weight of 374.49 g/mol. Its IUPAC name is 5-[4-(2,6-dimethyl-4-pyridinyl)piperazine-1-carbonyl]-1-(2-methoxyethyl)piperidin-2-one.
Molecular Properties
| Compound Name | 5-[4-(2,6-dimethyl-4-pyridinyl)piperazine-1-carbonyl]-1-(2-methoxyethyl)piperidin-2-one |
| PubChem CID | 45192162 |
| Molecular Formula | C20H30N4O3 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | 5-[4-(2,6-dimethyl-4-pyridinyl)piperazine-1-carbonyl]-1-(2-methoxyethyl)piperidin-2-one |
| SMILES | COCCN1CC(C(=O)N2CCN(c3cc(C)nc(C)c3)CC2)CCC1=O |
| InChI | InChI=1S/C20H30N4O3/c1-15-12-18(13-16(2)21-15)22-6-8-23(9-7-22)20(26)17-4-5-19(25)24(14-17)10-11-27-3/h12-13,17H,4-11,14H2,1-3H3 |
| InChIKey | JFFFRHCSXATWFQ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 65.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[4-(2,6-dimethyl-4-pyridinyl)piperazine-1-carbonyl]-1-(2-methoxyethyl)piperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(2,6-dimethyl-4-pyridinyl)piperazine-1-carbonyl]-1-(2-methoxyethyl)piperidin-2-one?
The IUPAC name of 5-[4-(2,6-dimethyl-4-pyridinyl)piperazine-1-carbonyl]-1-(2-methoxyethyl)piperidin-2-one (CID 45192162) is 5-[4-(2,6-dimethyl-4-pyridinyl)piperazine-1-carbonyl]-1-(2-methoxyethyl)piperidin-2-one.
What is the SMILES notation for 5-[4-(2,6-dimethyl-4-pyridinyl)piperazine-1-carbonyl]-1-(2-methoxyethyl)piperidin-2-one?
The canonical SMILES for 5-[4-(2,6-dimethyl-4-pyridinyl)piperazine-1-carbonyl]-1-(2-methoxyethyl)piperidin-2-one is COCCN1CC(C(=O)N2CCN(c3cc(C)nc(C)c3)CC2)CCC1=O.
What is the InChIKey of 5-[4-(2,6-dimethyl-4-pyridinyl)piperazine-1-carbonyl]-1-(2-methoxyethyl)piperidin-2-one?
The InChIKey is JFFFRHCSXATWFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30N4O3/c1-15-12-18(13-16(2)21-15)22-6-8-23(9-7-22)20(26)17-4-5-19(25)24(14-17)10-11-27-3/h12-13,17H,4-11,14H2,1-3H3.
What are the key properties of 5-[4-(2,6-dimethyl-4-pyridinyl)piperazine-1-carbonyl]-1-(2-methoxyethyl)piperidin-2-one?
5-[4-(2,6-dimethyl-4-pyridinyl)piperazine-1-carbonyl]-1-(2-methoxyethyl)piperidin-2-one has a molecular weight of 374.49 g/mol, XLogP of 1.23, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(2,6-dimethyl-4-pyridinyl)piperazine-1-carbonyl]-1-(2-methoxyethyl)piperidin-2-one is sourced from PubChem (CID 45192162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).