C16H28N2O4 — CID 25293036
(3S)-N-[(1-hydroxycyclohexyl)methyl]-1-(2-methoxyethyl)-6-oxopiperidine-3-carboxamide (PubChem CID 25293036) has the molecular formula C16H28N2O4 and a molecular weight of 312.41 g/mol. Its IUPAC name is (3S)-N-[(1-hydroxycyclohexyl)methyl]-1-(2-methoxyethyl)-6-oxopiperidine-3-carboxamide.
| Compound Name | (3S)-N-[(1-hydroxycyclohexyl)methyl]-1-(2-methoxyethyl)-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 25293036 |
| Molecular Formula | C16H28N2O4 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | (3S)-N-[(1-hydroxycyclohexyl)methyl]-1-(2-methoxyethyl)-6-oxopiperidine-3-carboxamide |
| SMILES | COCCN1C[C@@H](C(=O)NCC2(O)CCCCC2)CCC1=O |
| InChI | InChI=1S/C16H28N2O4/c1-22-10-9-18-11-13(5-6-14(18)19)15(20)17-12-16(21)7-3-2-4-8-16/h13,21H,2-12H2,1H3,(H,17,20)/t13-/m0/s1 |
| InChIKey | YHSSDNZOBGYPMA-ZDUSSCGKSA-N |
| XLogP | 0.68 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |