C21H30N2O4 — CID 26316413
(3S)-1-(2-methoxyethyl)-6-oxo-N-[(4-phenyloxan-4-yl)methyl]piperidine-3-carboxamide (PubChem CID 26316413) has the molecular formula C21H30N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is (3S)-1-(2-methoxyethyl)-6-oxo-N-[(4-phenyloxan-4-yl)methyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-(2-methoxyethyl)-6-oxo-N-[(4-phenyloxan-4-yl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 26316413 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | (3S)-1-(2-methoxyethyl)-6-oxo-N-[(4-phenyloxan-4-yl)methyl]piperidine-3-carboxamide |
| SMILES | COCCN1C[C@@H](C(=O)NCC2(c3ccccc3)CCOCC2)CCC1=O |
| InChI | InChI=1S/C21H30N2O4/c1-26-14-11-23-15-17(7-8-19(23)24)20(25)22-16-21(9-12-27-13-10-21)18-5-3-2-4-6-18/h2-6,17H,7-16H2,1H3,(H,22,25)/t17-/m0/s1 |
| InChIKey | XJFXCPNOAUBCOB-KRWDZBQOSA-N |
| XLogP | 1.74 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |