C20H26N4O3 — CID 45236878
1-(2-methoxyethyl)-6-oxo-N-[2-(1-phenylpyrazol-4-yl)ethyl]piperidine-3-carboxamide (PubChem CID 45236878) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-6-oxo-N-[2-(1-phenylpyrazol-4-yl)ethyl]piperidine-3-carboxamide.
| Compound Name | 1-(2-methoxyethyl)-6-oxo-N-[2-(1-phenylpyrazol-4-yl)ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 45236878 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 1-(2-methoxyethyl)-6-oxo-N-[2-(1-phenylpyrazol-4-yl)ethyl]piperidine-3-carboxamide |
| SMILES | COCCN1CC(C(=O)NCCc2cnn(-c3ccccc3)c2)CCC1=O |
| InChI | InChI=1S/C20H26N4O3/c1-27-12-11-23-15-17(7-8-19(23)25)20(26)21-10-9-16-13-22-24(14-16)18-5-3-2-4-6-18/h2-6,13-14,17H,7-12,15H2,1H3,(H,21,26) |
| InChIKey | KZXGVHGQWDNRGF-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |