C8H13N3O4 — CID 175102268
2-[(5S)-5-methyl-2,3-dioxopiperazin-1-yl]ethyl carbamate (PubChem CID 175102268) has the molecular formula C8H13N3O4 and a molecular weight of 215.21 g/mol. Its IUPAC name is 2-[(5S)-5-methyl-2,3-dioxopiperazin-1-yl]ethyl carbamate.
| Compound Name | 2-[(5S)-5-methyl-2,3-dioxopiperazin-1-yl]ethyl carbamate |
|---|---|
| PubChem CID | 175102268 |
| Molecular Formula | C8H13N3O4 |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 2-[(5S)-5-methyl-2,3-dioxopiperazin-1-yl]ethyl carbamate |
| SMILES | C[C@H]1CN(CCOC(N)=O)C(=O)C(=O)N1 |
| InChI | InChI=1S/C8H13N3O4/c1-5-4-11(2-3-15-8(9)14)7(13)6(12)10-5/h5H,2-4H2,1H3,(H2,9,14)(H,10,12)/t5-/m0/s1 |
| InChIKey | SEPPPKIHVDEUTC-YFKPBYRVSA-N |
| XLogP | -1.57 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|