C10H12N2O2S — CID 90141343
2-(2H-1,3-benzothiazol-3-yl)ethyl carbamate (PubChem CID 90141343) has the molecular formula C10H12N2O2S and a molecular weight of 224.28 g/mol. Its IUPAC name is 2-(2H-1,3-benzothiazol-3-yl)ethyl carbamate.
| Compound Name | 2-(2H-1,3-benzothiazol-3-yl)ethyl carbamate |
|---|---|
| PubChem CID | 90141343 |
| Molecular Formula | C10H12N2O2S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 2-(2H-1,3-benzothiazol-3-yl)ethyl carbamate |
| SMILES | NC(=O)OCCN1CSc2ccccc21 |
| InChI | InChI=1S/C10H12N2O2S/c11-10(13)14-6-5-12-7-15-9-4-2-1-3-8(9)12/h1-4H,5-7H2,(H2,11,13) |
| InChIKey | UWGJBXWVFLFMJB-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |