C14H13NS — CID 5080554
3-benzyl-2H-1,3-benzothiazole (PubChem CID 5080554) has the molecular formula C14H13NS and a molecular weight of 227.33 g/mol. Its IUPAC name is 3-benzyl-2H-1,3-benzothiazole.
| Compound Name | 3-benzyl-2H-1,3-benzothiazole |
|---|---|
| PubChem CID | 5080554 |
| Molecular Formula | C14H13NS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 3-benzyl-2H-1,3-benzothiazole |
| SMILES | c1ccc(CN2CSc3ccccc32)cc1 |
| InChI | InChI=1S/C14H13NS/c1-2-6-12(7-3-1)10-15-11-16-14-9-5-4-8-13(14)15/h1-9H,10-11H2 |
| InChIKey | CPKPUGGZBRKEAX-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |