C10H12N2S — CID 15163853
3-benzyl-1,3-thiazolidin-2-imine (PubChem CID 15163853) has the molecular formula C10H12N2S and a molecular weight of 192.29 g/mol. Its IUPAC name is 3-benzyl-1,3-thiazolidin-2-imine.
| Compound Name | 3-benzyl-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 15163853 |
| Molecular Formula | C10H12N2S |
| Molecular Weight | 192.29 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 3-benzyl-1,3-thiazolidin-2-imine |
| SMILES | [H]/N=C1\SCCN1Cc1ccccc1 |
| InChI | InChI=1S/C10H12N2S/c11-10-12(6-7-13-10)8-9-4-2-1-3-5-9/h1-5,11H,6-8H2/b11-10- |
| InChIKey | PFJYWEKDUVKYSO-KHPPLWFESA-N |
| XLogP | 2.17 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|