About 3-benzyl-2H-1,3-benzothiazole;hydrobromide
3-benzyl-2H-1,3-benzothiazole;hydrobromide (PubChem CID 173117012) has the molecular formula C14H14BrNS
and a molecular weight of 308.24 g/mol. Its IUPAC name is 3-benzyl-2H-1,3-benzothiazole;hydrobromide.
Molecular Properties
| Compound Name | 3-benzyl-2H-1,3-benzothiazole;hydrobromide |
| PubChem CID | 173117012 |
| Molecular Formula | C14H14BrNS |
| Molecular Weight | 308.24 g/mol |
| Exact Mass | 307.00 |
| IUPAC Name | 3-benzyl-2H-1,3-benzothiazole;hydrobromide |
| SMILES | Br.c1ccc(CN2CSc3ccccc32)cc1 |
| InChI | InChI=1S/C14H13NS.BrH/c1-2-6-12(7-3-1)10-15-11-16-14-9-5-4-8-13(14)15;/h1-9H,10-11H2;1H |
| InChIKey | PLQXAYRDCZHJQE-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.24 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-benzyl-2H-1,3-benzothiazole;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-2H-1,3-benzothiazole;hydrobromide?
The IUPAC name of 3-benzyl-2H-1,3-benzothiazole;hydrobromide (CID 173117012) is 3-benzyl-2H-1,3-benzothiazole;hydrobromide.
What is the SMILES notation for 3-benzyl-2H-1,3-benzothiazole;hydrobromide?
The canonical SMILES for 3-benzyl-2H-1,3-benzothiazole;hydrobromide is Br.c1ccc(CN2CSc3ccccc32)cc1.
What is the InChIKey of 3-benzyl-2H-1,3-benzothiazole;hydrobromide?
The InChIKey is PLQXAYRDCZHJQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NS.BrH/c1-2-6-12(7-3-1)10-15-11-16-14-9-5-4-8-13(14)15;/h1-9H,10-11H2;1H.
What are the key properties of 3-benzyl-2H-1,3-benzothiazole;hydrobromide?
3-benzyl-2H-1,3-benzothiazole;hydrobromide has a molecular weight of 308.24 g/mol, XLogP of 4.33, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-2H-1,3-benzothiazole;hydrobromide is sourced from PubChem (CID 173117012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).