C11H14ClN3OS — CID 170909376
5-benzyl-2-imino-3-methyl-1,3,5-thiadiazinan-4-one;hydrochloride (PubChem CID 170909376) has the molecular formula C11H14ClN3OS and a molecular weight of 271.77 g/mol. Its IUPAC name is 5-benzyl-2-imino-3-methyl-1,3,5-thiadiazinan-4-one;hydrochloride.
| Compound Name | 5-benzyl-2-imino-3-methyl-1,3,5-thiadiazinan-4-one;hydrochloride |
|---|---|
| PubChem CID | 170909376 |
| Molecular Formula | C11H14ClN3OS |
| Molecular Weight | 271.77 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 5-benzyl-2-imino-3-methyl-1,3,5-thiadiazinan-4-one;hydrochloride |
| SMILES | Cl.[H]/N=C1\SCN(Cc2ccccc2)C(=O)N1C |
| InChI | InChI=1S/C11H13N3OS.ClH/c1-13-10(12)16-8-14(11(13)15)7-9-5-3-2-4-6-9;/h2-6,12H,7-8H2,1H3;1H/b12-10-; |
| InChIKey | COTLJICPNZNIJD-BBJSDXRSSA-N |
| XLogP | 2.60 |
| TPSA | 47.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.77 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|