C21H19N3OS2 — CID 142860495
(5Z)-3-benzyl-5-(3,5-dimethyl-4-phenyl-1,3-thiazol-2-ylidene)-2-imino-1,3-thiazolidin-4-one (PubChem CID 142860495) has the molecular formula C21H19N3OS2 and a molecular weight of 393.54 g/mol. Its IUPAC name is (5Z)-3-benzyl-5-(3,5-dimethyl-4-phenyl-1,3-thiazol-2-ylidene)-2-imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-benzyl-5-(3,5-dimethyl-4-phenyl-1,3-thiazol-2-ylidene)-2-imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 142860495 |
| Molecular Formula | C21H19N3OS2 |
| Molecular Weight | 393.54 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | (5Z)-3-benzyl-5-(3,5-dimethyl-4-phenyl-1,3-thiazol-2-ylidene)-2-imino-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1\S/C(=C2\SC(C)=C(c3ccccc3)N2C)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C21H19N3OS2/c1-14-17(16-11-7-4-8-12-16)23(2)20(26-14)18-19(25)24(21(22)27-18)13-15-9-5-3-6-10-15/h3-12,22H,13H2,1-2H3/b20-18-,22-21- |
| InChIKey | SORJARBMFJDEHY-QHQVFXOCSA-N |
| XLogP | 4.93 |
| TPSA | 47.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.54 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|