C19H17N3OS2 — CID 142264437
(5E)-3-benzyl-2-imino-5-(4-methyl-1,4-benzothiazin-3-ylidene)-1,3-thiazolidin-4-one (PubChem CID 142264437) has the molecular formula C19H17N3OS2 and a molecular weight of 367.50 g/mol. Its IUPAC name is (5E)-3-benzyl-2-imino-5-(4-methyl-1,4-benzothiazin-3-ylidene)-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-benzyl-2-imino-5-(4-methyl-1,4-benzothiazin-3-ylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 142264437 |
| Molecular Formula | C19H17N3OS2 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | (5E)-3-benzyl-2-imino-5-(4-methyl-1,4-benzothiazin-3-ylidene)-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1\S/C(=C2\CSc3ccccc3N2C)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C19H17N3OS2/c1-21-14-9-5-6-10-16(14)24-12-15(21)17-18(23)22(19(20)25-17)11-13-7-3-2-4-8-13/h2-10,20H,11-12H2,1H3/b17-15+,20-19- |
| InChIKey | REDOTJJPZXOCBO-YQLZRBDRSA-N |
| XLogP | 4.15 |
| TPSA | 47.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|