C31H31N7OS2 — CID 142860461
4-[[(2Z)-2-(3-benzyl-2-imino-4-oxo-1,3-thiazolidin-5-ylidene)-3-methyl-1,3-benzothiazol-6-yl]amino]butanenitrile;4-(ethylamino)benzonitrile (PubChem CID 142860461) has the molecular formula C31H31N7OS2 and a molecular weight of 581.77 g/mol. Its IUPAC name is 4-[[(2Z)-2-(3-benzyl-2-imino-4-oxo-1,3-thiazolidin-5-ylidene)-3-methyl-1,3-benzothiazol-6-yl]amino]butanenitrile;4-(ethylamino)benzonitrile.
| Compound Name | 4-[[(2Z)-2-(3-benzyl-2-imino-4-oxo-1,3-thiazolidin-5-ylidene)-3-methyl-1,3-benzothiazol-6-yl]amino]butanenitrile;4-(ethylamino)benzonitrile |
|---|---|
| PubChem CID | 142860461 |
| Molecular Formula | C31H31N7OS2 |
| Molecular Weight | 581.77 g/mol |
| Exact Mass | 581.20 |
| IUPAC Name | 4-[[(2Z)-2-(3-benzyl-2-imino-4-oxo-1,3-thiazolidin-5-ylidene)-3-methyl-1,3-benzothiazol-6-yl]amino]butanenitrile;4-(ethylamino)benzonitrile |
| SMILES | CCNc1ccc(C#N)cc1.[H]/N=C1\S/C(=C2\Sc3cc(NCCCC#N)ccc3N2C)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C22H21N5OS2.C9H10N2/c1-26-17-10-9-16(25-12-6-5-11-23)13-18(17)29-21(26)19-20(28)27(22(24)30-19)14-15-7-3-2-4-8-15;1-2-11-9-5-3-8(7-10)4-6-9/h2-4,7-10,13,24-25H,5-6,12,14H2,1H3;3-6,11H,2H2,1H3/b21-19-,24-22-; |
| InChIKey | KTUKFLCWTOXMKR-PMFXAVBZSA-N |
| XLogP | 6.81 |
| TPSA | 119.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.77 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|