C31H35N5O3S2 — CID 142264296
(5E)-3-benzyl-5-[1-[5-(3-hydroxypropoxy)-N-methyl-2-sulfanylanilino]ethylidene]-2-imino-1,3-thiazolidin-4-one;4-(ethylamino)benzonitrile (PubChem CID 142264296) has the molecular formula C31H35N5O3S2 and a molecular weight of 589.79 g/mol. Its IUPAC name is (5E)-3-benzyl-5-[1-[5-(3-hydroxypropoxy)-N-methyl-2-sulfanylanilino]ethylidene]-2-imino-1,3-thiazolidin-4-one;4-(ethylamino)benzonitrile.
| Compound Name | (5E)-3-benzyl-5-[1-[5-(3-hydroxypropoxy)-N-methyl-2-sulfanylanilino]ethylidene]-2-imino-1,3-thiazolidin-4-one;4-(ethylamino)benzonitrile |
|---|---|
| PubChem CID | 142264296 |
| Molecular Formula | C31H35N5O3S2 |
| Molecular Weight | 589.79 g/mol |
| Exact Mass | 589.22 |
| IUPAC Name | (5E)-3-benzyl-5-[1-[5-(3-hydroxypropoxy)-N-methyl-2-sulfanylanilino]ethylidene]-2-imino-1,3-thiazolidin-4-one;4-(ethylamino)benzonitrile |
| SMILES | CCNc1ccc(C#N)cc1.[H]/N=C1\S/C(=C(\C)N(C)c2cc(OCCCO)ccc2S)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C22H25N3O3S2.C9H10N2/c1-15(24(2)18-13-17(9-10-19(18)29)28-12-6-11-26)20-21(27)25(22(23)30-20)14-16-7-4-3-5-8-16;1-2-11-9-5-3-8(7-10)4-6-9/h3-5,7-10,13,23,26,29H,6,11-12,14H2,1-2H3;3-6,11H,2H2,1H3/b20-15+,23-22-; |
| InChIKey | RGLJJYRRHBJVBJ-FLFCUXQFSA-N |
| XLogP | 6.10 |
| TPSA | 112.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.79 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|