C31H33N5O2S2 — CID 142264282
(2E)-4-benzyl-6-imino-2-[[[(Z)-1-(2-methoxyphenyl)-2-sulfanylethenyl]-methylamino]methylidene]thiomorpholin-3-one;4-(ethylamino)benzonitrile (PubChem CID 142264282) has the molecular formula C31H33N5O2S2 and a molecular weight of 571.77 g/mol. Its IUPAC name is (2E)-4-benzyl-6-imino-2-[[[(Z)-1-(2-methoxyphenyl)-2-sulfanylethenyl]-methylamino]methylidene]thiomorpholin-3-one;4-(ethylamino)benzonitrile.
| Compound Name | (2E)-4-benzyl-6-imino-2-[[[(Z)-1-(2-methoxyphenyl)-2-sulfanylethenyl]-methylamino]methylidene]thiomorpholin-3-one;4-(ethylamino)benzonitrile |
|---|---|
| PubChem CID | 142264282 |
| Molecular Formula | C31H33N5O2S2 |
| Molecular Weight | 571.77 g/mol |
| Exact Mass | 571.21 |
| IUPAC Name | (2E)-4-benzyl-6-imino-2-[[[(Z)-1-(2-methoxyphenyl)-2-sulfanylethenyl]-methylamino]methylidene]thiomorpholin-3-one;4-(ethylamino)benzonitrile |
| SMILES | CCNc1ccc(C#N)cc1.[H]/N=C1/CN(Cc2ccccc2)C(=O)/C(=C\N(C)/C(=C\S)c2ccccc2OC)S1 |
| InChI | InChI=1S/C22H23N3O2S2.C9H10N2/c1-24(18(15-28)17-10-6-7-11-19(17)27-2)13-20-22(26)25(14-21(23)29-20)12-16-8-4-3-5-9-16;1-2-11-9-5-3-8(7-10)4-6-9/h3-11,13,15,23,28H,12,14H2,1-2H3;3-6,11H,2H2,1H3/b18-15-,20-13+,23-21-; |
| InChIKey | CQRREBCTTVHZIX-RLBMYGOGSA-N |
| XLogP | 6.44 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.77 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|