C23H25N3O3S2 — CID 142264332
(5E)-3-benzyl-5-[[[(Z)-1-(2,4-dimethoxyphenyl)-2-sulfanylethenyl]-methylamino]methylidene]-2-methylimino-1,3-thiazolidin-4-one (PubChem CID 142264332) has the molecular formula C23H25N3O3S2 and a molecular weight of 455.61 g/mol. Its IUPAC name is (5E)-3-benzyl-5-[[[(Z)-1-(2,4-dimethoxyphenyl)-2-sulfanylethenyl]-methylamino]methylidene]-2-methylimino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-benzyl-5-[[[(Z)-1-(2,4-dimethoxyphenyl)-2-sulfanylethenyl]-methylamino]methylidene]-2-methylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 142264332 |
| Molecular Formula | C23H25N3O3S2 |
| Molecular Weight | 455.61 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | (5E)-3-benzyl-5-[[[(Z)-1-(2,4-dimethoxyphenyl)-2-sulfanylethenyl]-methylamino]methylidene]-2-methylimino-1,3-thiazolidin-4-one |
| SMILES | C/N=C1\S/C(=C/N(C)/C(=C\S)c2ccc(OC)cc2OC)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C23H25N3O3S2/c1-24-23-26(13-16-8-6-5-7-9-16)22(27)21(31-23)14-25(2)19(15-30)18-11-10-17(28-3)12-20(18)29-4/h5-12,14-15,30H,13H2,1-4H3/b19-15-,21-14+,24-23- |
| InChIKey | NXEMQKBNXXZMIP-STNQCNNFSA-N |
| XLogP | 4.47 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.61 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|