C30H32N4O3S — CID 143187443
(5Z)-3-benzyl-2-[2-(ethylamino)-5-propanoylphenyl]imino-5-[(4-methoxy-N-methylanilino)methylidene]-1,3-thiazolidin-4-one (PubChem CID 143187443) has the molecular formula C30H32N4O3S and a molecular weight of 528.68 g/mol. Its IUPAC name is (5Z)-3-benzyl-2-[2-(ethylamino)-5-propanoylphenyl]imino-5-[(4-methoxy-N-methylanilino)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-benzyl-2-[2-(ethylamino)-5-propanoylphenyl]imino-5-[(4-methoxy-N-methylanilino)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 143187443 |
| Molecular Formula | C30H32N4O3S |
| Molecular Weight | 528.68 g/mol |
| Exact Mass | 528.22 |
| IUPAC Name | (5Z)-3-benzyl-2-[2-(ethylamino)-5-propanoylphenyl]imino-5-[(4-methoxy-N-methylanilino)methylidene]-1,3-thiazolidin-4-one |
| SMILES | CCNc1ccc(C(=O)CC)cc1/N=C1\S/C(=C\N(C)c2ccc(OC)cc2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C30H32N4O3S/c1-5-27(35)22-12-17-25(31-6-2)26(18-22)32-30-34(19-21-10-8-7-9-11-21)29(36)28(38-30)20-33(3)23-13-15-24(37-4)16-14-23/h7-18,20,31H,5-6,19H2,1-4H3/b28-20-,32-30- |
| InChIKey | HUUJOHPOYLPADR-GMYVBOCGSA-N |
| XLogP | 6.46 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.68 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|