C32H38N6O3S2 — CID 142860521
N-[3-[[(5E)-3-benzyl-5-[1-(5-methoxy-N-methyl-2-sulfanylanilino)ethylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-4-(ethylamino)phenyl]-2-(dimethylamino)acetamide (PubChem CID 142860521) has the molecular formula C32H38N6O3S2 and a molecular weight of 618.83 g/mol. Its IUPAC name is N-[3-[[(5E)-3-benzyl-5-[1-(5-methoxy-N-methyl-2-sulfanylanilino)ethylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-4-(ethylamino)phenyl]-2-(dimethylamino)acetamide.
| Compound Name | N-[3-[[(5E)-3-benzyl-5-[1-(5-methoxy-N-methyl-2-sulfanylanilino)ethylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-4-(ethylamino)phenyl]-2-(dimethylamino)acetamide |
|---|---|
| PubChem CID | 142860521 |
| Molecular Formula | C32H38N6O3S2 |
| Molecular Weight | 618.83 g/mol |
| Exact Mass | 618.24 |
| IUPAC Name | N-[3-[[(5E)-3-benzyl-5-[1-(5-methoxy-N-methyl-2-sulfanylanilino)ethylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-4-(ethylamino)phenyl]-2-(dimethylamino)acetamide |
| SMILES | CCNc1ccc(NC(=O)CN(C)C)cc1/N=C1\S/C(=C(\C)N(C)c2cc(OC)ccc2S)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C32H38N6O3S2/c1-7-33-25-15-13-23(34-29(39)20-36(3)4)17-26(25)35-32-38(19-22-11-9-8-10-12-22)31(40)30(43-32)21(2)37(5)27-18-24(41-6)14-16-28(27)42/h8-18,33,42H,7,19-20H2,1-6H3,(H,34,39)/b30-21+,35-32- |
| InChIKey | XIIWIDWWSRJVHX-FCMDVMHKSA-N |
| XLogP | 6.05 |
| TPSA | 89.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.83 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|