C27H31N5OS2 — CID 142860563
3-[[(5E)-3-cyclohexyl-5-[1-(N-methyl-2-sulfanylanilino)ethylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-4-(ethylamino)benzonitrile (PubChem CID 142860563) has the molecular formula C27H31N5OS2 and a molecular weight of 505.71 g/mol. Its IUPAC name is 3-[[(5E)-3-cyclohexyl-5-[1-(N-methyl-2-sulfanylanilino)ethylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-4-(ethylamino)benzonitrile.
| Compound Name | 3-[[(5E)-3-cyclohexyl-5-[1-(N-methyl-2-sulfanylanilino)ethylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-4-(ethylamino)benzonitrile |
|---|---|
| PubChem CID | 142860563 |
| Molecular Formula | C27H31N5OS2 |
| Molecular Weight | 505.71 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | 3-[[(5E)-3-cyclohexyl-5-[1-(N-methyl-2-sulfanylanilino)ethylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-4-(ethylamino)benzonitrile |
| SMILES | CCNc1ccc(C#N)cc1/N=C1\S/C(=C(\C)N(C)c2ccccc2S)C(=O)N1C1CCCCC1 |
| InChI | InChI=1S/C27H31N5OS2/c1-4-29-21-15-14-19(17-28)16-22(21)30-27-32(20-10-6-5-7-11-20)26(33)25(35-27)18(2)31(3)23-12-8-9-13-24(23)34/h8-9,12-16,20,29,34H,4-7,10-11H2,1-3H3/b25-18+,30-27- |
| InChIKey | IPYYFMPWGXSGMA-ZXICBKASSA-N |
| XLogP | 6.54 |
| TPSA | 71.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.71 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|