C24H23N5OS2 — CID 5375820
4-(ethylamino)-3-[[(5E)-3-ethyl-4-oxo-5-(3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-2-ylidene]amino]benzonitrile (PubChem CID 5375820) has the molecular formula C24H23N5OS2 and a molecular weight of 461.62 g/mol. Its IUPAC name is 4-(ethylamino)-3-[[(5E)-3-ethyl-4-oxo-5-(3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-2-ylidene]amino]benzonitrile.
| Compound Name | 4-(ethylamino)-3-[[(5E)-3-ethyl-4-oxo-5-(3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-2-ylidene]amino]benzonitrile |
|---|---|
| PubChem CID | 5375820 |
| Molecular Formula | C24H23N5OS2 |
| Molecular Weight | 461.62 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | 4-(ethylamino)-3-[[(5E)-3-ethyl-4-oxo-5-(3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-2-ylidene]amino]benzonitrile |
| SMILES | C=CCN1/C(=C2\S/C(=N\c3cc(C#N)ccc3NCC)N(CC)C2=O)Sc2ccccc21 |
| InChI | InChI=1S/C24H23N5OS2/c1-4-13-29-19-9-7-8-10-20(19)31-23(29)21-22(30)28(6-3)24(32-21)27-18-14-16(15-25)11-12-17(18)26-5-2/h4,7-12,14,26H,1,5-6,13H2,2-3H3/b23-21+,27-24- |
| InChIKey | MZJUNKVGZQZJAT-RSDHFFELSA-N |
| XLogP | 5.54 |
| TPSA | 71.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.62 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|