C24H24ClN5OS2 — CID 3725969
3-[[3-butyl-5-(5-chloro-3-methyl-1,3-benzothiazol-2-ylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]-4-(ethylamino)benzonitrile (PubChem CID 3725969) has the molecular formula C24H24ClN5OS2 and a molecular weight of 498.08 g/mol. Its IUPAC name is 3-[[3-butyl-5-(5-chloro-3-methyl-1,3-benzothiazol-2-ylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]-4-(ethylamino)benzonitrile.
| Compound Name | 3-[[3-butyl-5-(5-chloro-3-methyl-1,3-benzothiazol-2-ylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]-4-(ethylamino)benzonitrile |
|---|---|
| PubChem CID | 3725969 |
| Molecular Formula | C24H24ClN5OS2 |
| Molecular Weight | 498.08 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | 3-[[3-butyl-5-(5-chloro-3-methyl-1,3-benzothiazol-2-ylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]-4-(ethylamino)benzonitrile |
| SMILES | CCCCN1C(=O)C(=C2Sc3ccc(Cl)cc3N2C)S/C1=N\c1cc(C#N)ccc1NCC |
| InChI | InChI=1S/C24H24ClN5OS2/c1-4-6-11-30-22(31)21(23-29(3)19-13-16(25)8-10-20(19)32-23)33-24(30)28-18-12-15(14-26)7-9-17(18)27-5-2/h7-10,12-13,27H,4-6,11H2,1-3H3/b23-21?,28-24- |
| InChIKey | QYOFHDNQJIXOFY-NIQWRRMZSA-N |
| XLogP | 6.42 |
| TPSA | 71.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.08 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|