C21H19BrClN3OS2 — CID 3786172
2-(4-bromophenyl)imino-3-butyl-5-(5-chloro-3-methyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one (PubChem CID 3786172) has the molecular formula C21H19BrClN3OS2 and a molecular weight of 508.89 g/mol. Its IUPAC name is 2-(4-bromophenyl)imino-3-butyl-5-(5-chloro-3-methyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one.
| Compound Name | 2-(4-bromophenyl)imino-3-butyl-5-(5-chloro-3-methyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3786172 |
| Molecular Formula | C21H19BrClN3OS2 |
| Molecular Weight | 508.89 g/mol |
| Exact Mass | 506.98 |
| IUPAC Name | 2-(4-bromophenyl)imino-3-butyl-5-(5-chloro-3-methyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one |
| SMILES | CCCCN1C(=O)C(=C2Sc3ccc(Cl)cc3N2C)S/C1=N\c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H19BrClN3OS2/c1-3-4-11-26-19(27)18(29-21(26)24-15-8-5-13(22)6-9-15)20-25(2)16-12-14(23)7-10-17(16)28-20/h5-10,12H,3-4,11H2,1-2H3/b20-18?,24-21- |
| InChIKey | CALMVJOHAMSPAX-VKNMOEGYSA-N |
| XLogP | 6.88 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.89 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|