C22H22BrN3OS2 — CID 6052382
(5Z)-2-(3-bromophenyl)imino-3-butyl-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one (PubChem CID 6052382) has the molecular formula C22H22BrN3OS2 and a molecular weight of 488.48 g/mol. Its IUPAC name is (5Z)-2-(3-bromophenyl)imino-3-butyl-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(3-bromophenyl)imino-3-butyl-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6052382 |
| Molecular Formula | C22H22BrN3OS2 |
| Molecular Weight | 488.48 g/mol |
| Exact Mass | 487.04 |
| IUPAC Name | (5Z)-2-(3-bromophenyl)imino-3-butyl-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one |
| SMILES | CCCCN1C(=O)/C(=C2/Sc3ccccc3N2CC)S/C1=N\c1cccc(Br)c1 |
| InChI | InChI=1S/C22H22BrN3OS2/c1-3-5-13-26-20(27)19(29-22(26)24-16-10-8-9-15(23)14-16)21-25(4-2)17-11-6-7-12-18(17)28-21/h6-12,14H,3-5,13H2,1-2H3/b21-19-,24-22- |
| InChIKey | USGURGAVJFZMKM-YJOHERITSA-N |
| XLogP | 6.61 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.48 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|