C29H26N4O3S2 — CID 3824391
3-butyl-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-2-[(7-nitro-9H-fluoren-2-yl)imino]-1,3-thiazolidin-4-one (PubChem CID 3824391) has the molecular formula C29H26N4O3S2 and a molecular weight of 542.69 g/mol. Its IUPAC name is 3-butyl-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-2-[(7-nitro-9H-fluoren-2-yl)imino]-1,3-thiazolidin-4-one.
| Compound Name | 3-butyl-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-2-[(7-nitro-9H-fluoren-2-yl)imino]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3824391 |
| Molecular Formula | C29H26N4O3S2 |
| Molecular Weight | 542.69 g/mol |
| Exact Mass | 542.14 |
| IUPAC Name | 3-butyl-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-2-[(7-nitro-9H-fluoren-2-yl)imino]-1,3-thiazolidin-4-one |
| SMILES | CCCCN1C(=O)C(=C2Sc3ccccc3N2CC)S/C1=N/c1ccc2c(c1)Cc1cc([N+](=O)[O-])ccc1-2 |
| InChI | InChI=1S/C29H26N4O3S2/c1-3-5-14-32-27(34)26(28-31(4-2)24-8-6-7-9-25(24)37-28)38-29(32)30-20-10-12-22-18(16-20)15-19-17-21(33(35)36)11-13-23(19)22/h6-13,16-17H,3-5,14-15H2,1-2H3/b28-26?,30-29+ |
| InChIKey | RWKAPPLWDIAOAE-KEGRMWRSSA-N |
| XLogP | 7.33 |
| TPSA | 79.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.69 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|