C22H21N3OS2 — CID 3740386
5-(3-ethyl-1,3-benzothiazol-2-ylidene)-2-(4-methylphenyl)imino-3-prop-2-enyl-1,3-thiazolidin-4-one (PubChem CID 3740386) has the molecular formula C22H21N3OS2 and a molecular weight of 407.56 g/mol. Its IUPAC name is 5-(3-ethyl-1,3-benzothiazol-2-ylidene)-2-(4-methylphenyl)imino-3-prop-2-enyl-1,3-thiazolidin-4-one.
| Compound Name | 5-(3-ethyl-1,3-benzothiazol-2-ylidene)-2-(4-methylphenyl)imino-3-prop-2-enyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3740386 |
| Molecular Formula | C22H21N3OS2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 5-(3-ethyl-1,3-benzothiazol-2-ylidene)-2-(4-methylphenyl)imino-3-prop-2-enyl-1,3-thiazolidin-4-one |
| SMILES | C=CCN1C(=O)C(=C2Sc3ccccc3N2CC)S/C1=N\c1ccc(C)cc1 |
| InChI | InChI=1S/C22H21N3OS2/c1-4-14-25-20(26)19(28-22(25)23-16-12-10-15(3)11-13-16)21-24(5-2)17-8-6-7-9-18(17)27-21/h4,6-13H,1,5,14H2,2-3H3/b21-19?,23-22- |
| InChIKey | RXKXABMJAOTFEL-PLFWMWSJSA-N |
| XLogP | 5.55 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|