C28H23N3OS2 — CID 92953051
(5E)-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-[4-[(Z)-2-phenylethenyl]phenyl]imino-3-prop-2-enyl-1,3-thiazolidin-4-one (PubChem CID 92953051) has the molecular formula C28H23N3OS2 and a molecular weight of 481.65 g/mol. Its IUPAC name is (5E)-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-[4-[(Z)-2-phenylethenyl]phenyl]imino-3-prop-2-enyl-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-[4-[(Z)-2-phenylethenyl]phenyl]imino-3-prop-2-enyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 92953051 |
| Molecular Formula | C28H23N3OS2 |
| Molecular Weight | 481.65 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | (5E)-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-[4-[(Z)-2-phenylethenyl]phenyl]imino-3-prop-2-enyl-1,3-thiazolidin-4-one |
| SMILES | C=CCN1C(=O)/C(=C2\Sc3ccccc3N2C)S/C1=N\c1ccc(/C=C\c2ccccc2)cc1 |
| InChI | InChI=1S/C28H23N3OS2/c1-3-19-31-26(32)25(27-30(2)23-11-7-8-12-24(23)33-27)34-28(31)29-22-17-15-21(16-18-22)14-13-20-9-5-4-6-10-20/h3-18H,1,19H2,2H3/b14-13-,27-25+,29-28- |
| InChIKey | CCIAAFBFJWSDFB-JODYGNNISA-N |
| XLogP | 7.02 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.65 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|