C20H17N3O3S3 — CID 3969574
N-[5-(3-methyl-1,3-benzothiazol-2-ylidene)-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]benzenesulfonamide (PubChem CID 3969574) has the molecular formula C20H17N3O3S3 and a molecular weight of 443.58 g/mol. Its IUPAC name is N-[5-(3-methyl-1,3-benzothiazol-2-ylidene)-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]benzenesulfonamide.
| Compound Name | N-[5-(3-methyl-1,3-benzothiazol-2-ylidene)-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 3969574 |
| Molecular Formula | C20H17N3O3S3 |
| Molecular Weight | 443.58 g/mol |
| Exact Mass | 443.04 |
| IUPAC Name | N-[5-(3-methyl-1,3-benzothiazol-2-ylidene)-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]benzenesulfonamide |
| SMILES | C=CCN1C(=O)C(=C2Sc3ccccc3N2C)SC1=NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H17N3O3S3/c1-3-13-23-18(24)17(19-22(2)15-11-7-8-12-16(15)27-19)28-20(23)21-29(25,26)14-9-5-4-6-10-14/h3-12H,1,13H2,2H3 |
| InChIKey | PNIZFLUQPCVNTI-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.58 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|