C23H22ClN3O3S3 — CID 4736541
4-chloro-N-[3-cyclohexyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide (PubChem CID 4736541) has the molecular formula C23H22ClN3O3S3 and a molecular weight of 520.10 g/mol. Its IUPAC name is 4-chloro-N-[3-cyclohexyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide.
| Compound Name | 4-chloro-N-[3-cyclohexyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 4736541 |
| Molecular Formula | C23H22ClN3O3S3 |
| Molecular Weight | 520.10 g/mol |
| Exact Mass | 519.05 |
| IUPAC Name | 4-chloro-N-[3-cyclohexyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide |
| SMILES | CN1C(=C2SC(=NS(=O)(=O)c3ccc(Cl)cc3)N(C3CCCCC3)C2=O)Sc2ccccc21 |
| InChI | InChI=1S/C23H22ClN3O3S3/c1-26-18-9-5-6-10-19(18)31-22(26)20-21(28)27(16-7-3-2-4-8-16)23(32-20)25-33(29,30)17-13-11-15(24)12-14-17/h5-6,9-14,16H,2-4,7-8H2,1H3 |
| InChIKey | QEXULKRDNPJVKC-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.10 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|