C23H21BrClN3OS2 — CID 3489778
2-(3-bromophenyl)imino-5-(5-chloro-3-methyl-1,3-benzothiazol-2-ylidene)-3-cyclohexyl-1,3-thiazolidin-4-one (PubChem CID 3489778) has the molecular formula C23H21BrClN3OS2 and a molecular weight of 534.93 g/mol. Its IUPAC name is 2-(3-bromophenyl)imino-5-(5-chloro-3-methyl-1,3-benzothiazol-2-ylidene)-3-cyclohexyl-1,3-thiazolidin-4-one.
| Compound Name | 2-(3-bromophenyl)imino-5-(5-chloro-3-methyl-1,3-benzothiazol-2-ylidene)-3-cyclohexyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3489778 |
| Molecular Formula | C23H21BrClN3OS2 |
| Molecular Weight | 534.93 g/mol |
| Exact Mass | 533.00 |
| IUPAC Name | 2-(3-bromophenyl)imino-5-(5-chloro-3-methyl-1,3-benzothiazol-2-ylidene)-3-cyclohexyl-1,3-thiazolidin-4-one |
| SMILES | CN1C(=C2S/C(=N\c3cccc(Br)c3)N(C3CCCCC3)C2=O)Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C23H21BrClN3OS2/c1-27-18-13-15(25)10-11-19(18)30-22(27)20-21(29)28(17-8-3-2-4-9-17)23(31-20)26-16-7-5-6-14(24)12-16/h5-7,10-13,17H,2-4,8-9H2,1H3/b22-20?,26-23- |
| InChIKey | ZCEQXDKGJGTTJN-BVWDTEKKSA-N |
| XLogP | 7.41 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.93 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|