C24H24ClN3O2S2 — CID 3708780
5-(5-chloro-3-methyl-1,3-benzothiazol-2-ylidene)-3-cyclohexyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 3708780) has the molecular formula C24H24ClN3O2S2 and a molecular weight of 486.06 g/mol. Its IUPAC name is 5-(5-chloro-3-methyl-1,3-benzothiazol-2-ylidene)-3-cyclohexyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | 5-(5-chloro-3-methyl-1,3-benzothiazol-2-ylidene)-3-cyclohexyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3708780 |
| Molecular Formula | C24H24ClN3O2S2 |
| Molecular Weight | 486.06 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | 5-(5-chloro-3-methyl-1,3-benzothiazol-2-ylidene)-3-cyclohexyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(/N=C2\SC(=C3Sc4ccc(Cl)cc4N3C)C(=O)N2C2CCCCC2)cc1 |
| InChI | InChI=1S/C24H24ClN3O2S2/c1-27-19-14-15(25)8-13-20(19)31-23(27)21-22(29)28(17-6-4-3-5-7-17)24(32-21)26-16-9-11-18(30-2)12-10-16/h8-14,17H,3-7H2,1-2H3/b23-21?,26-24- |
| InChIKey | OTOCBJLVWQINFN-YDMHGLEBSA-N |
| XLogP | 6.66 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.06 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|