C24H18ClN3O2S2 — CID 3094698
(5Z)-2-(4-chlorophenyl)imino-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-3-phenyl-1,3-thiazolidin-4-one (PubChem CID 3094698) has the molecular formula C24H18ClN3O2S2 and a molecular weight of 480.01 g/mol. Its IUPAC name is (5Z)-2-(4-chlorophenyl)imino-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-3-phenyl-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(4-chlorophenyl)imino-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-3-phenyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3094698 |
| Molecular Formula | C24H18ClN3O2S2 |
| Molecular Weight | 480.01 g/mol |
| Exact Mass | 479.05 |
| IUPAC Name | (5Z)-2-(4-chlorophenyl)imino-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-3-phenyl-1,3-thiazolidin-4-one |
| SMILES | COc1ccc2c(c1)N(C)/C(=C1/S/C(=N\c3ccc(Cl)cc3)N(c3ccccc3)C1=O)S2 |
| InChI | InChI=1S/C24H18ClN3O2S2/c1-27-19-14-18(30-2)12-13-20(19)31-23(27)21-22(29)28(17-6-4-3-5-7-17)24(32-21)26-16-10-8-15(25)9-11-16/h3-14H,1-2H3/b23-21-,26-24- |
| InChIKey | LYPZCEHLPNBMEE-NPGCFZLRSA-N |
| XLogP | 6.53 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.01 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|